C27H23ClFN3O2 — CID 155411049
(2S)-2-(4-chlorophenyl)-2-[(6-fluoronaphthalen-2-yl)-formylamino]-N-(3-pyridin-3-ylpropyl)acetamide (PubChem CID 155411049) has the molecular formula C27H23ClFN3O2 and a molecular weight of 475.95 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-2-[(6-fluoronaphthalen-2-yl)-formylamino]-N-(3-pyridin-3-ylpropyl)acetamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-2-[(6-fluoronaphthalen-2-yl)-formylamino]-N-(3-pyridin-3-ylpropyl)acetamide |
|---|---|
| PubChem CID | 155411049 |
| Molecular Formula | C27H23ClFN3O2 |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-2-[(6-fluoronaphthalen-2-yl)-formylamino]-N-(3-pyridin-3-ylpropyl)acetamide |
| SMILES | O=CN(c1ccc2cc(F)ccc2c1)[C@H](C(=O)NCCCc1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClFN3O2/c28-23-9-5-20(6-10-23)26(27(34)31-14-2-4-19-3-1-13-30-17-19)32(18-33)25-12-8-21-15-24(29)11-7-22(21)16-25/h1,3,5-13,15-18,26H,2,4,14H2,(H,31,34)/t26-/m0/s1 |
| InChIKey | FZTHJJARTPMTFU-SANMLTNESA-N |
| XLogP | 5.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|