C23H16F3N5O — CID 155412451
1-[3-cyano-1-(2-methyl-3-pyridinyl)indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 155412451) has the molecular formula C23H16F3N5O and a molecular weight of 435.41 g/mol. Its IUPAC name is 1-[3-cyano-1-(2-methyl-3-pyridinyl)indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-cyano-1-(2-methyl-3-pyridinyl)indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 155412451 |
| Molecular Formula | C23H16F3N5O |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-[3-cyano-1-(2-methyl-3-pyridinyl)indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ncccc1-n1cc(C#N)c2ccc(NC(=O)Nc3ccc(C(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C23H16F3N5O/c1-14-20(3-2-10-28-14)31-13-15(12-27)19-9-8-18(11-21(19)31)30-22(32)29-17-6-4-16(5-7-17)23(24,25)26/h2-11,13H,1H3,(H2,29,30,32) |
| InChIKey | IYJXPSHDGRUCKG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |