C17H15F3N4O — CID 74763930
1-(2,3-dimethylindazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 74763930) has the molecular formula C17H15F3N4O and a molecular weight of 348.33 g/mol. Its IUPAC name is 1-(2,3-dimethylindazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2,3-dimethylindazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 74763930 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-(2,3-dimethylindazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1c2ccc(NC(=O)Nc3ccc(C(F)(F)F)cc3)cc2nn1C |
| InChI | InChI=1S/C17H15F3N4O/c1-10-14-8-7-13(9-15(14)23-24(10)2)22-16(25)21-12-5-3-11(4-6-12)17(18,19)20/h3-9H,1-2H3,(H2,21,22,25) |
| InChIKey | FNDUCPMDJZOWNX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |