C16H15FN4O — CID 74763932
1-(2,3-dimethylindazol-6-yl)-3-(4-fluorophenyl)urea (PubChem CID 74763932) has the molecular formula C16H15FN4O and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-(2,3-dimethylindazol-6-yl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(2,3-dimethylindazol-6-yl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 74763932 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(2,3-dimethylindazol-6-yl)-3-(4-fluorophenyl)urea |
| SMILES | Cc1c2ccc(NC(=O)Nc3ccc(F)cc3)cc2nn1C |
| InChI | InChI=1S/C16H15FN4O/c1-10-14-8-7-13(9-15(14)20-21(10)2)19-16(22)18-12-5-3-11(17)4-6-12/h3-9H,1-2H3,(H2,18,19,22) |
| InChIKey | FBOCKYLSKOYQNY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |