C13H11F3N2OS — CID 2808215
1-(4-methylthiophen-2-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 2808215) has the molecular formula C13H11F3N2OS and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-(4-methylthiophen-2-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-methylthiophen-2-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 2808215 |
| Molecular Formula | C13H11F3N2OS |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-(4-methylthiophen-2-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1csc(NC(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C13H11F3N2OS/c1-8-6-11(20-7-8)18-12(19)17-10-4-2-9(3-5-10)13(14,15)16/h2-7H,1H3,(H2,17,18,19) |
| InChIKey | PXICKOGZWJTPIR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |