C16H11F5N2O2 — CID 155412924
3-[4-[(2,6-difluoro-3-pyridinyl)methyl]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 155412924) has the molecular formula C16H11F5N2O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 3-[4-[(2,6-difluoro-3-pyridinyl)methyl]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-[4-[(2,6-difluoro-3-pyridinyl)methyl]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 155412924 |
| Molecular Formula | C16H11F5N2O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-[4-[(2,6-difluoro-3-pyridinyl)methyl]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccc(Cc3ccc(F)nc3F)cc2)=NO1 |
| InChI | InChI=1S/C16H11F5N2O2/c17-13-6-5-11(14(18)22-13)7-9-1-3-10(4-2-9)12-8-15(24,25-23-12)16(19,20)21/h1-6,24H,7-8H2 |
| InChIKey | OAVNGHMJUURVFV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|