C14H12ClF2N3O2 — CID 155413951
5-[chloro(difluoro)methyl]-3-[4-(1-methylpyrazol-4-yl)phenyl]-4H-1,2-oxazol-5-ol (PubChem CID 155413951) has the molecular formula C14H12ClF2N3O2 and a molecular weight of 327.72 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-3-[4-(1-methylpyrazol-4-yl)phenyl]-4H-1,2-oxazol-5-ol.
| Compound Name | 5-[chloro(difluoro)methyl]-3-[4-(1-methylpyrazol-4-yl)phenyl]-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 155413951 |
| Molecular Formula | C14H12ClF2N3O2 |
| Molecular Weight | 327.72 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-3-[4-(1-methylpyrazol-4-yl)phenyl]-4H-1,2-oxazol-5-ol |
| SMILES | Cn1cc(-c2ccc(C3=NOC(O)(C(F)(F)Cl)C3)cc2)cn1 |
| InChI | InChI=1S/C14H12ClF2N3O2/c1-20-8-11(7-18-20)9-2-4-10(5-3-9)12-6-13(21,22-19-12)14(15,16)17/h2-5,7-8,21H,6H2,1H3 |
| InChIKey | GRJOPVKAQBUHGA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.72 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|