C15H28N2O3S2 — CID 155415650
2-amino-3-[(2-methyl-3-oxobutyl)disulfanyl]-N-(2-oxoheptan-3-yl)propanamide (PubChem CID 155415650) has the molecular formula C15H28N2O3S2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-amino-3-[(2-methyl-3-oxobutyl)disulfanyl]-N-(2-oxoheptan-3-yl)propanamide.
| Compound Name | 2-amino-3-[(2-methyl-3-oxobutyl)disulfanyl]-N-(2-oxoheptan-3-yl)propanamide |
|---|---|
| PubChem CID | 155415650 |
| Molecular Formula | C15H28N2O3S2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-amino-3-[(2-methyl-3-oxobutyl)disulfanyl]-N-(2-oxoheptan-3-yl)propanamide |
| SMILES | CCCCC(NC(=O)C(N)CSSCC(C)C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H28N2O3S2/c1-5-6-7-14(12(4)19)17-15(20)13(16)9-22-21-8-10(2)11(3)18/h10,13-14H,5-9,16H2,1-4H3,(H,17,20) |
| InChIKey | XPSYJANVSFDCKA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|