C25H38N4O5S2 — CID 155416048
(1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone (PubChem CID 155416048) has the molecular formula C25H38N4O5S2 and a molecular weight of 538.74 g/mol. Its IUPAC name is (1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone.
| Compound Name | (1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone |
|---|---|
| PubChem CID | 155416048 |
| Molecular Formula | C25H38N4O5S2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone |
| SMILES | C=C1NC(C(C)C)C(=O)O[C@@H]2/C=C\CCSSCC(NC(=O)[C@H](C(C)C)NC(=O)C2)C(=O)N/C1=C/C |
| InChI | InChI=1S/C25H38N4O5S2/c1-7-18-16(6)26-22(15(4)5)25(33)34-17-10-8-9-11-35-36-13-19(23(31)27-18)28-24(32)21(14(2)3)29-20(30)12-17/h7-8,10,14-15,17,19,21-22,26H,6,9,11-13H2,1-5H3,(H,27,31)(H,28,32)(H,29,30)/b10-8-,18-7+/t17-,19?,21+,22?/m1/s1 |
| InChIKey | VZCLVEHEFUCLOV-MPVUYMOHSA-N |
| XLogP | 2.42 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|