C21H16F4N2O4 — CID 155416989
2-(3-fluoro-2-methoxyphenoxy)-N-(8-oxa-2-azabicyclo[5.1.0]octa-3,5-dien-5-yl)-5-(trifluoromethyl)benzamide (PubChem CID 155416989) has the molecular formula C21H16F4N2O4 and a molecular weight of 436.36 g/mol. Its IUPAC name is 2-(3-fluoro-2-methoxyphenoxy)-N-(8-oxa-2-azabicyclo[5.1.0]octa-3,5-dien-5-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(3-fluoro-2-methoxyphenoxy)-N-(8-oxa-2-azabicyclo[5.1.0]octa-3,5-dien-5-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155416989 |
| Molecular Formula | C21H16F4N2O4 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-(3-fluoro-2-methoxyphenoxy)-N-(8-oxa-2-azabicyclo[5.1.0]octa-3,5-dien-5-yl)-5-(trifluoromethyl)benzamide |
| SMILES | COc1c(F)cccc1Oc1ccc(C(F)(F)F)cc1C(=O)NC1=CC2OC2NC=C1 |
| InChI | InChI=1S/C21H16F4N2O4/c1-29-18-14(22)3-2-4-16(18)30-15-6-5-11(21(23,24)25)9-13(15)19(28)27-12-7-8-26-20-17(10-12)31-20/h2-10,17,20,26H,1H3,(H,27,28) |
| InChIKey | SREHWJBMLQHKDL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|