C23H21F6N2O8P — CID 162595656
[4-[[2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]-2-methoxy-2H-pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 162595656) has the molecular formula C23H21F6N2O8P and a molecular weight of 598.39 g/mol. Its IUPAC name is [4-[[2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]-2-methoxy-2H-pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [4-[[2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]-2-methoxy-2H-pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 162595656 |
| Molecular Formula | C23H21F6N2O8P |
| Molecular Weight | 598.39 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | [4-[[2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]-2-methoxy-2H-pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc(F)ccc1Oc1cc(C(F)(F)C(F)(F)F)ccc1C(=O)NC1=CC(OC)N(COP(=O)(O)O)C=C1 |
| InChI | InChI=1S/C23H21F6N2O8P/c1-36-19-10-14(24)4-6-17(19)39-18-9-13(22(25,26)23(27,28)29)3-5-16(18)21(32)30-15-7-8-31(20(11-15)37-2)12-38-40(33,34)35/h3-11,20H,12H2,1-2H3,(H,30,32)(H2,33,34,35) |
| InChIKey | VNYMEPDGXSBALG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|