C26H25F6NO5 — CID 144678764
ethane;2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde;4-(methylamino)benzoic acid (PubChem CID 144678764) has the molecular formula C26H25F6NO5 and a molecular weight of 545.48 g/mol. Its IUPAC name is ethane;2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde;4-(methylamino)benzoic acid.
| Compound Name | ethane;2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde;4-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 144678764 |
| Molecular Formula | C26H25F6NO5 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | ethane;2-(4-fluoro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde;4-(methylamino)benzoic acid |
| SMILES | CC.CNc1ccc(C(=O)O)cc1.COc1cc(F)ccc1Oc1cc(C(F)(F)C(F)(F)F)ccc1C=O |
| InChI | InChI=1S/C16H10F6O3.C8H9NO2.C2H6/c1-24-14-7-11(17)4-5-12(14)25-13-6-10(3-2-9(13)8-23)15(18,19)16(20,21)22;1-9-7-4-2-6(3-5-7)8(10)11;1-2/h2-8H,1H3;2-5,9H,1H3,(H,10,11);1-2H3 |
| InChIKey | MIJMASNNTFVFDZ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|