C22H20N6O2S — CID 155418136
N-[4-[[5-methyl-3-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1H-pyrazol-4-yl]diazenyl]phenyl]acetamide (PubChem CID 155418136) has the molecular formula C22H20N6O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is N-[4-[[5-methyl-3-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1H-pyrazol-4-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[4-[[5-methyl-3-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1H-pyrazol-4-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 155418136 |
| Molecular Formula | C22H20N6O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[4-[[5-methyl-3-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1H-pyrazol-4-yl]diazenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=N/c2c(C)[nH]n(Cc3nc(-c4ccccc4)cs3)c2=O)cc1 |
| InChI | InChI=1S/C22H20N6O2S/c1-14-21(26-25-18-10-8-17(9-11-18)23-15(2)29)22(30)28(27-14)12-20-24-19(13-31-20)16-6-4-3-5-7-16/h3-11,13,27H,12H2,1-2H3,(H,23,29)/b26-25+ |
| InChIKey | KEAWVPDJTMFGDR-OCEACIFDSA-N |
| XLogP | 5.03 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|