C43H36N2 — CID 155419603
2-[4-[7-tert-butyl-1-methyl-3-(4-pyridin-2-ylphenyl)-2H-pyren-1-yl]phenyl]pyridine (PubChem CID 155419603) has the molecular formula C43H36N2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 2-[4-[7-tert-butyl-1-methyl-3-(4-pyridin-2-ylphenyl)-2H-pyren-1-yl]phenyl]pyridine.
| Compound Name | 2-[4-[7-tert-butyl-1-methyl-3-(4-pyridin-2-ylphenyl)-2H-pyren-1-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 155419603 |
| Molecular Formula | C43H36N2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 2-[4-[7-tert-butyl-1-methyl-3-(4-pyridin-2-ylphenyl)-2H-pyren-1-yl]phenyl]pyridine |
| SMILES | CC(C)(C)c1cc2ccc3c4c(ccc(c1)c24)=C(c1ccc(-c2ccccn2)cc1)CC3(C)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C43H36N2/c1-42(2,3)34-25-31-17-21-35-36(28-11-13-29(14-12-28)38-9-5-7-23-44-38)27-43(4,37-22-18-32(26-34)40(31)41(35)37)33-19-15-30(16-20-33)39-10-6-8-24-45-39/h5-26H,27H2,1-4H3 |
| InChIKey | RKUJNWCLJNBYAL-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |