C15H10N2O3 — CID 155420261
6-amino-5-[2-(3-formylphenyl)ethynyl]pyridine-3-carboxylic acid (PubChem CID 155420261) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-amino-5-[2-(3-formylphenyl)ethynyl]pyridine-3-carboxylic acid.
| Compound Name | 6-amino-5-[2-(3-formylphenyl)ethynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155420261 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 6-amino-5-[2-(3-formylphenyl)ethynyl]pyridine-3-carboxylic acid |
| SMILES | Nc1ncc(C(=O)O)cc1C#Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C15H10N2O3/c16-14-12(7-13(8-17-14)15(19)20)5-4-10-2-1-3-11(6-10)9-18/h1-3,6-9H,(H2,16,17)(H,19,20) |
| InChIKey | LKHVMCDJEQMYQN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|