About 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine
6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine (PubChem CID 155420747) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine.
Analyze 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine?
The IUPAC name of 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine (CID 155420747) is 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine.
What is the SMILES notation for 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine?
The canonical SMILES for 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine is NC1=CN=C2CCCCN2C1.
What is the InChIKey of 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine?
The InChIKey is OIQPAGBNPVXRJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c9-7-5-10-8-3-1-2-4-11(8)6-7/h5H,1-4,6,9H2.
What are the key properties of 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine?
6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine has a molecular weight of 151.21 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-3-amine is sourced from PubChem (CID 155420747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).