C10H16N2O — CID 90226489
3,5,6,7,8,9,10,11-octahydroimidazo[1,2-a]azonin-2-one (PubChem CID 90226489) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,5,6,7,8,9,10,11-octahydroimidazo[1,2-a]azonin-2-one.
| Compound Name | 3,5,6,7,8,9,10,11-octahydroimidazo[1,2-a]azonin-2-one |
|---|---|
| PubChem CID | 90226489 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3,5,6,7,8,9,10,11-octahydroimidazo[1,2-a]azonin-2-one |
| SMILES | O=C1CN2CCCCCCCC2=N1 |
| InChI | InChI=1S/C10H16N2O/c13-10-8-12-7-5-3-1-2-4-6-9(12)11-10/h1-8H2 |
| InChIKey | GSCCFQILCGEVEF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |