C14H17ClN2 — CID 18992973
4-chloro-3-methyl-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline (PubChem CID 18992973) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 4-chloro-3-methyl-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline.
| Compound Name | 4-chloro-3-methyl-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline |
|---|---|
| PubChem CID | 18992973 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-chloro-3-methyl-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline |
| SMILES | Cc1ccc2c(c1Cl)N=C1CCCCCN1C2 |
| InChI | InChI=1S/C14H17ClN2/c1-10-6-7-11-9-17-8-4-2-3-5-12(17)16-14(11)13(10)15/h6-7H,2-5,8-9H2,1H3 |
| InChIKey | XNZNWEWELRKKMT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |