C10H10N2 — CID 15852512
2,8-dihydro-1H-azeto[2,1-b]quinazoline (PubChem CID 15852512) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,8-dihydro-1H-azeto[2,1-b]quinazoline.
| Compound Name | 2,8-dihydro-1H-azeto[2,1-b]quinazoline |
|---|---|
| PubChem CID | 15852512 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2,8-dihydro-1H-azeto[2,1-b]quinazoline |
| SMILES | c1ccc2c(c1)CN1CCC1=N2 |
| InChI | InChI=1S/C10H10N2/c1-2-4-9-8(3-1)7-12-6-5-10(12)11-9/h1-4H,5-7H2 |
| InChIKey | GPQLJEOJBFJUOH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |