C22H27ClN6O3 — CID 155420815
N-[[4-amino-7-chloro-1-(4-morpholin-4-yl-4-oxobutyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylformamide (PubChem CID 155420815) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is N-[[4-amino-7-chloro-1-(4-morpholin-4-yl-4-oxobutyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylformamide.
| Compound Name | N-[[4-amino-7-chloro-1-(4-morpholin-4-yl-4-oxobutyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylformamide |
|---|---|
| PubChem CID | 155420815 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[[4-amino-7-chloro-1-(4-morpholin-4-yl-4-oxobutyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylformamide |
| SMILES | CCN(C=O)Cc1nc2c(N)nc3cc(Cl)ccc3c2n1CCCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H27ClN6O3/c1-2-27(14-30)13-18-26-20-21(16-6-5-15(23)12-17(16)25-22(20)24)29(18)7-3-4-19(31)28-8-10-32-11-9-28/h5-6,12,14H,2-4,7-11,13H2,1H3,(H2,24,25) |
| InChIKey | YZBCKOGDEGBAQV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|