C19H21N5O4 — CID 11574514
2-[(9-amino-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl)oxy]-1-morpholin-4-ylethanone (PubChem CID 11574514) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-[(9-amino-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl)oxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(9-amino-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl)oxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 11574514 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-[(9-amino-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl)oxy]-1-morpholin-4-ylethanone |
| SMILES | Nc1nc2cc(OCC(=O)N3CCOCC3)ccc2c2c1nc1n2CCOC1 |
| InChI | InChI=1S/C19H21N5O4/c20-19-17-18(24-5-8-27-10-15(24)22-17)13-2-1-12(9-14(13)21-19)28-11-16(25)23-3-6-26-7-4-23/h1-2,9H,3-8,10-11H2,(H2,20,21) |
| InChIKey | USUCCAAPUYOTPP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |