C23H23FN4O2 — CID 67157344
3-(2-fluoropropan-2-yl)-5-phenylmethoxy-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine (PubChem CID 67157344) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-(2-fluoropropan-2-yl)-5-phenylmethoxy-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine.
| Compound Name | 3-(2-fluoropropan-2-yl)-5-phenylmethoxy-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine |
|---|---|
| PubChem CID | 67157344 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3-(2-fluoropropan-2-yl)-5-phenylmethoxy-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine |
| SMILES | CC(C)(F)c1cc(OCc2ccccc2)cc2nc(N)c3nc4n(c3c12)CCOC4 |
| InChI | InChI=1S/C23H23FN4O2/c1-23(2,24)16-10-15(30-12-14-6-4-3-5-7-14)11-17-19(16)21-20(22(25)26-17)27-18-13-29-9-8-28(18)21/h3-7,10-11H,8-9,12-13H2,1-2H3,(H2,25,26) |
| InChIKey | ZLIXKOPYLUPWMF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |