C18H19N3O2S — CID 22283202
7-morpholin-4-yl-4-phenylmethoxy-1,3-benzothiazol-2-amine (PubChem CID 22283202) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 7-morpholin-4-yl-4-phenylmethoxy-1,3-benzothiazol-2-amine.
| Compound Name | 7-morpholin-4-yl-4-phenylmethoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 22283202 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 7-morpholin-4-yl-4-phenylmethoxy-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(OCc3ccccc3)ccc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C18H19N3O2S/c19-18-20-16-15(23-12-13-4-2-1-3-5-13)7-6-14(17(16)24-18)21-8-10-22-11-9-21/h1-7H,8-12H2,(H2,19,20) |
| InChIKey | HVGQRDDNSYZQQI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|