C22H32N4O3 — CID 90711913
ethane;methyl pentanoate;15-oxa-8,11,18-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine (PubChem CID 90711913) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethane;methyl pentanoate;15-oxa-8,11,18-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine.
| Compound Name | ethane;methyl pentanoate;15-oxa-8,11,18-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine |
|---|---|
| PubChem CID | 90711913 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | ethane;methyl pentanoate;15-oxa-8,11,18-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine |
| SMILES | CC.CCCCC(=O)OC.Nc1nc2ccccc2c2c1nc1n2CCOCC1 |
| InChI | InChI=1S/C14H14N4O.C6H12O2.C2H6/c15-14-12-13(9-3-1-2-4-10(9)16-14)18-6-8-19-7-5-11(18)17-12;1-3-4-5-6(7)8-2;1-2/h1-4H,5-8H2,(H2,15,16);3-5H2,1-2H3;1-2H3 |
| InChIKey | OPFKZUIMATVDRL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |