C15H17N5S — CID 143078035
14-methylsulfanyl-8,11,14,18-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine (PubChem CID 143078035) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 14-methylsulfanyl-8,11,14,18-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine.
| Compound Name | 14-methylsulfanyl-8,11,14,18-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine |
|---|---|
| PubChem CID | 143078035 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 14-methylsulfanyl-8,11,14,18-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,11-hexaen-9-amine |
| SMILES | CSN1CCCn2c(nc3c(N)nc4ccccc4c32)C1 |
| InChI | InChI=1S/C15H17N5S/c1-21-19-7-4-8-20-12(9-19)18-13-14(20)10-5-2-3-6-11(10)17-15(13)16/h2-3,5-6H,4,7-9H2,1H3,(H2,16,17) |
| InChIKey | WFEJQWUPHDZISJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|