C15H18N4 — CID 155368483
1-[(2S)-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 155368483) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 1-[(2S)-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[(2S)-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 155368483 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[(2S)-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(C)[C@H](C)n1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C15H18N4/c1-9(2)10(3)19-8-17-13-14(19)11-6-4-5-7-12(11)18-15(13)16/h4-10H,1-3H3,(H2,16,18)/t10-/m0/s1 |
| InChIKey | UQVZKKGBZNRKGH-JTQLQIEISA-N |
| XLogP | 3.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |