C17H22N4O — CID 146637091
1-[(2R)-1-ethoxy-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 146637091) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(2R)-1-ethoxy-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[(2R)-1-ethoxy-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 146637091 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[(2R)-1-ethoxy-3-methylbutan-2-yl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCOC[C@@H](C(C)C)n1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C17H22N4O/c1-4-22-9-14(11(2)3)21-10-19-15-16(21)12-7-5-6-8-13(12)20-17(15)18/h5-8,10-11,14H,4,9H2,1-3H3,(H2,18,20)/t14-/m0/s1 |
| InChIKey | GKLSJVOKLQCOBF-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |