C17H22N4O2 — CID 150473168
4-(4-aminoimidazo[4,5-c]quinolin-1-yl)-5-methoxy-2-methylpentan-2-ol (PubChem CID 150473168) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-(4-aminoimidazo[4,5-c]quinolin-1-yl)-5-methoxy-2-methylpentan-2-ol.
| Compound Name | 4-(4-aminoimidazo[4,5-c]quinolin-1-yl)-5-methoxy-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 150473168 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-(4-aminoimidazo[4,5-c]quinolin-1-yl)-5-methoxy-2-methylpentan-2-ol |
| SMILES | COCC(CC(C)(C)O)n1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,22)8-11(9-23-3)21-10-19-14-15(21)12-6-4-5-7-13(12)20-16(14)18/h4-7,10-11,22H,8-9H2,1-3H3,(H2,18,20) |
| InChIKey | HSFWIRKOUMMWPC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |