About 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride
1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride (PubChem CID 162715622) has the molecular formula C26H33ClN4O
and a molecular weight of 453.03 g/mol. Its IUPAC name is 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride |
| PubChem CID | 162715622 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride |
| SMILES | CCCCOc1ccc(C[C@@H](CCCC)n2cnc3c(N)nc4ccccc4c32)cc1.Cl |
| InChI | InChI=1S/C26H32N4O.ClH/c1-3-5-9-20(17-19-12-14-21(15-13-19)31-16-6-4-2)30-18-28-24-25(30)22-10-7-8-11-23(22)29-26(24)27;/h7-8,10-15,18,20H,3-6,9,16-17H2,1-2H3,(H2,27,29);1H/t20-;/m1./s1 |
| InChIKey | WIXWFWVKAXSOTR-VEIFNGETSA-N |
| XLogP | 6.74 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride?
The IUPAC name of 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride (CID 162715622) is 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride.
What is the SMILES notation for 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride?
The canonical SMILES for 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride is CCCCOc1ccc(C[C@@H](CCCC)n2cnc3c(N)nc4ccccc4c32)cc1.Cl.
What is the InChIKey of 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride?
The InChIKey is WIXWFWVKAXSOTR-VEIFNGETSA-N. The full InChI is InChI=1S/C26H32N4O.ClH/c1-3-5-9-20(17-19-12-14-21(15-13-19)31-16-6-4-2)30-18-28-24-25(30)22-10-7-8-11-23(22)29-26(24)27;/h7-8,10-15,18,20H,3-6,9,16-17H2,1-2H3,(H2,27,29);1H/t20-;/m1./s1.
What are the key properties of 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride?
1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride has a molecular weight of 453.03 g/mol, XLogP of 6.74, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-1-(4-butoxyphenyl)hexan-2-yl]imidazo[4,5-c]quinolin-4-amine;hydrochloride is sourced from PubChem (CID 162715622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).