C22H22N4O3 — CID 59119319
4-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)-3-methylbutoxy]benzoic acid (PubChem CID 59119319) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)-3-methylbutoxy]benzoic acid.
| Compound Name | 4-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)-3-methylbutoxy]benzoic acid |
|---|---|
| PubChem CID | 59119319 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)-3-methylbutoxy]benzoic acid |
| SMILES | CC(C)C(COc1ccc(C(=O)O)cc1)n1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C22H22N4O3/c1-13(2)18(11-29-15-9-7-14(8-10-15)22(27)28)26-12-24-19-20(26)16-5-3-4-6-17(16)25-21(19)23/h3-10,12-13,18H,11H2,1-2H3,(H2,23,25)(H,27,28) |
| InChIKey | FPOWSVPGPCENCB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |