C14H17N5O — CID 152657233
1-[1-(2-aminoethoxy)ethyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 152657233) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[1-(2-aminoethoxy)ethyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[1-(2-aminoethoxy)ethyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 152657233 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[1-(2-aminoethoxy)ethyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(OCCN)n1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C14H17N5O/c1-9(20-7-6-15)19-8-17-12-13(19)10-4-2-3-5-11(10)18-14(12)16/h2-5,8-9H,6-7,15H2,1H3,(H2,16,18) |
| InChIKey | ZITVIGBWKCWCJA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |