C25H30N4O2 — CID 155355545
1-[1-(4-butoxyphenyl)-3-ethoxypropan-2-yl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 155355545) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[1-(4-butoxyphenyl)-3-ethoxypropan-2-yl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[1-(4-butoxyphenyl)-3-ethoxypropan-2-yl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 155355545 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-[1-(4-butoxyphenyl)-3-ethoxypropan-2-yl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCOc1ccc(CC(COCC)n2cnc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C25H30N4O2/c1-3-5-14-31-20-12-10-18(11-13-20)15-19(16-30-4-2)29-17-27-23-24(29)21-8-6-7-9-22(21)28-25(23)26/h6-13,17,19H,3-5,14-16H2,1-2H3,(H2,26,28) |
| InChIKey | XLDZGCHKOGBAKZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|