C26H40N6O2 — CID 142145838
1-[3-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)butoxy]ethyl]hexyl]-3-propan-2-ylurea (PubChem CID 142145838) has the molecular formula C26H40N6O2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 1-[3-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)butoxy]ethyl]hexyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)butoxy]ethyl]hexyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 142145838 |
| Molecular Formula | C26H40N6O2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1-[3-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)butoxy]ethyl]hexyl]-3-propan-2-ylurea |
| SMILES | CCCC(CCNC(=O)NC(C)C)CCOCC(CC)n1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C26H40N6O2/c1-5-9-19(12-14-28-26(33)30-18(3)4)13-15-34-16-20(6-2)32-17-29-23-24(32)21-10-7-8-11-22(21)31-25(23)27/h7-8,10-11,17-20H,5-6,9,12-16H2,1-4H3,(H2,27,31)(H2,28,30,33) |
| InChIKey | SYPJNNDVSQIPNS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|