C58H107NO — CID 155421286
4-[2-[(Z)-but-2-enyl]-3-[9-hexyl-2-methylidene-5-(2-methylidene-3-pentylundecyl)-8-propan-2-ylideneheptadecyl]cyclopentyl]oxypent-4-en-1-amine (PubChem CID 155421286) has the molecular formula C58H107NO and a molecular weight of 834.50 g/mol. Its IUPAC name is 4-[2-[(Z)-but-2-enyl]-3-[9-hexyl-2-methylidene-5-(2-methylidene-3-pentylundecyl)-8-propan-2-ylideneheptadecyl]cyclopentyl]oxypent-4-en-1-amine.
| Compound Name | 4-[2-[(Z)-but-2-enyl]-3-[9-hexyl-2-methylidene-5-(2-methylidene-3-pentylundecyl)-8-propan-2-ylideneheptadecyl]cyclopentyl]oxypent-4-en-1-amine |
|---|---|
| PubChem CID | 155421286 |
| Molecular Formula | C58H107NO |
| Molecular Weight | 834.50 g/mol |
| Exact Mass | 833.84 |
| IUPAC Name | 4-[2-[(Z)-but-2-enyl]-3-[9-hexyl-2-methylidene-5-(2-methylidene-3-pentylundecyl)-8-propan-2-ylideneheptadecyl]cyclopentyl]oxypent-4-en-1-amine |
| SMILES | C=C(CCC(CCC(=C(C)C)C(CCCCCC)CCCCCCCC)CC(=C)C(CCCCC)CCCCCCCC)CC1CCC(OC(=C)CCCN)C1C/C=C\C |
| InChI | InChI=1S/C58H107NO/c1-11-16-21-24-26-30-35-53(34-28-19-14-4)50(9)47-52(41-43-56(48(6)7)54(36-29-23-18-13-3)37-31-27-25-22-17-12-2)40-39-49(8)46-55-42-44-58(57(55)38-20-15-5)60-51(10)33-32-45-59/h15,20,52-55,57-58H,8-14,16-19,21-47,59H2,1-7H3/b20-15- |
| InChIKey | QUGPVKFJWOIYTC-HKWRFOASSA-N |
| XLogP | 19.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.50 |
| LogP ≤ 5 | 19.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|