C26H20N4O4 — CID 155422283
5-(4-isoquinolin-6-ylphenoxy)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid (PubChem CID 155422283) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 5-(4-isoquinolin-6-ylphenoxy)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(4-isoquinolin-6-ylphenoxy)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155422283 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 5-(4-isoquinolin-6-ylphenoxy)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(Cn2nnc(C(=O)O)c2Oc2ccc(-c3ccc4cnccc4c3)cc2)cc1 |
| InChI | InChI=1S/C26H20N4O4/c1-33-22-8-2-17(3-9-22)16-30-25(24(26(31)32)28-29-30)34-23-10-6-18(7-11-23)19-4-5-21-15-27-13-12-20(21)14-19/h2-15H,16H2,1H3,(H,31,32) |
| InChIKey | HTQQGRUNXDDBFP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |