C20H15ClN4O3 — CID 155422178
5-(7-chloroquinolin-3-yl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid (PubChem CID 155422178) has the molecular formula C20H15ClN4O3 and a molecular weight of 394.82 g/mol. Its IUPAC name is 5-(7-chloroquinolin-3-yl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(7-chloroquinolin-3-yl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155422178 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 5-(7-chloroquinolin-3-yl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(Cn2nnc(C(=O)O)c2-c2cnc3cc(Cl)ccc3c2)cc1 |
| InChI | InChI=1S/C20H15ClN4O3/c1-28-16-6-2-12(3-7-16)11-25-19(18(20(26)27)23-24-25)14-8-13-4-5-15(21)9-17(13)22-10-14/h2-10H,11H2,1H3,(H,26,27) |
| InChIKey | IFZVVOUUGWRGHN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |