C27H30N4O — CID 155425893
5-[3-[(6R)-5-azaspiro[2.4]heptan-6-yl]-4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine (PubChem CID 155425893) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is 5-[3-[(6R)-5-azaspiro[2.4]heptan-6-yl]-4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine.
| Compound Name | 5-[3-[(6R)-5-azaspiro[2.4]heptan-6-yl]-4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 155425893 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 5-[3-[(6R)-5-azaspiro[2.4]heptan-6-yl]-4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(C3CCOCC3)c([C@H]3CC4(CC4)CN3)c2)cc1-c1ccncc1 |
| InChI | InChI=1S/C27H30N4O/c28-26-23(18-3-9-29-10-4-18)14-21(16-30-26)20-1-2-22(19-5-11-32-12-6-19)24(13-20)25-15-27(7-8-27)17-31-25/h1-4,9-10,13-14,16,19,25,31H,5-8,11-12,15,17H2,(H2,28,30)/t25-/m1/s1 |
| InChIKey | PORMKASBOIWHDS-RUZDIDTESA-N |
| XLogP | 5.10 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |