C26H32N4O2 — CID 155744979
5-[4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine;1,4-oxazepane (PubChem CID 155744979) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 5-[4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine;1,4-oxazepane.
| Compound Name | 5-[4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine;1,4-oxazepane |
|---|---|
| PubChem CID | 155744979 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5-[4-(oxan-4-yl)phenyl]-3-pyridin-4-ylpyridin-2-amine;1,4-oxazepane |
| SMILES | C1CNCCOC1.Nc1ncc(-c2ccc(C3CCOCC3)cc2)cc1-c1ccncc1 |
| InChI | InChI=1S/C21H21N3O.C5H11NO/c22-21-20(18-5-9-23-10-6-18)13-19(14-24-21)16-3-1-15(2-4-16)17-7-11-25-12-8-17;1-2-6-3-5-7-4-1/h1-6,9-10,13-14,17H,7-8,11-12H2,(H2,22,24);6H,1-5H2 |
| InChIKey | CPIQCGTVYGXCBP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |