C25H27FN4O — CID 155426012
3-(2-fluoro-4-pyridinyl)-5-[4-(oxan-4-yl)-3-[(2R)-pyrrolidin-2-yl]phenyl]pyridin-2-amine (PubChem CID 155426012) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-(2-fluoro-4-pyridinyl)-5-[4-(oxan-4-yl)-3-[(2R)-pyrrolidin-2-yl]phenyl]pyridin-2-amine.
| Compound Name | 3-(2-fluoro-4-pyridinyl)-5-[4-(oxan-4-yl)-3-[(2R)-pyrrolidin-2-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 155426012 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 3-(2-fluoro-4-pyridinyl)-5-[4-(oxan-4-yl)-3-[(2R)-pyrrolidin-2-yl]phenyl]pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(C3CCOCC3)c([C@H]3CCCN3)c2)cc1-c1ccnc(F)c1 |
| InChI | InChI=1S/C25H27FN4O/c26-24-14-18(5-9-29-24)21-13-19(15-30-25(21)27)17-3-4-20(16-6-10-31-11-7-16)22(12-17)23-2-1-8-28-23/h3-5,9,12-16,23,28H,1-2,6-8,10-11H2,(H2,27,30)/t23-/m1/s1 |
| InChIKey | CQYWFKZRGWZONR-HSZRJFAPSA-N |
| XLogP | 4.85 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|