C8H5F3N2O2S — CID 155432053
1-amino-1-oxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one (PubChem CID 155432053) has the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. Its IUPAC name is 1-amino-1-oxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one.
| Compound Name | 1-amino-1-oxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 155432053 |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-amino-1-oxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one |
| SMILES | NS1(=O)=NC(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C8H5F3N2O2S/c9-8(10,11)4-1-2-5-6(3-4)16(12,15)13-7(5)14/h1-3H,(H2,12,13,14,15) |
| InChIKey | BKZLSWYYOKRZFL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |