About 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine
6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 155437096) has the molecular formula C7H6F2N4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine |
| PubChem CID | 155437096 |
| Molecular Formula | C7H6F2N4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | Nc1cnn2cc(C(F)F)cnc12 |
| InChI | InChI=1S/C7H6F2N4/c8-6(9)4-1-11-7-5(10)2-12-13(7)3-4/h1-3,6H,10H2 |
| InChIKey | PRWPAHFZNGZIED-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine (CID 155437096) is 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine is Nc1cnn2cc(C(F)F)cnc12.
What is the InChIKey of 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is PRWPAHFZNGZIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N4/c8-6(9)4-1-11-7-5(10)2-12-13(7)3-4/h1-3,6H,10H2.
What are the key properties of 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 184.15 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 155437096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).