C20H23N5O3 — CID 155437859
2-[2-(4-formylcyclohexyl)-6-methoxyindazol-5-yl]-1H-pyridazine-3-carboxamide (PubChem CID 155437859) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[2-(4-formylcyclohexyl)-6-methoxyindazol-5-yl]-1H-pyridazine-3-carboxamide.
| Compound Name | 2-[2-(4-formylcyclohexyl)-6-methoxyindazol-5-yl]-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 155437859 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[2-(4-formylcyclohexyl)-6-methoxyindazol-5-yl]-1H-pyridazine-3-carboxamide |
| SMILES | COc1cc2nn(C3CCC(C=O)CC3)cc2cc1N1NC=CC=C1C(N)=O |
| InChI | InChI=1S/C20H23N5O3/c1-28-19-10-16-14(9-18(19)25-17(20(21)27)3-2-8-22-25)11-24(23-16)15-6-4-13(12-26)5-7-15/h2-3,8-13,15,22H,4-7H2,1H3,(H2,21,27) |
| InChIKey | MUVGSYVJWJHWAK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|