C22H26FN3O2 — CID 163362497
4-[5-(5-fluoro-2H-pyridin-1-yl)-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexane-1-carbaldehyde (PubChem CID 163362497) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[5-(5-fluoro-2H-pyridin-1-yl)-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[5-(5-fluoro-2H-pyridin-1-yl)-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 163362497 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[5-(5-fluoro-2H-pyridin-1-yl)-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexane-1-carbaldehyde |
| SMILES | CC(C)(O)c1cc2nn(C3CCC(C=O)CC3)cc2cc1N1C=C(F)C=CC1 |
| InChI | InChI=1S/C22H26FN3O2/c1-22(2,28)19-11-20-16(10-21(19)25-9-3-4-17(23)13-25)12-26(24-20)18-7-5-15(14-27)6-8-18/h3-4,10-15,18,28H,5-9H2,1-2H3 |
| InChIKey | SSGJPQLZKQUDBH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|