C11H19NO3 — CID 155441773
(2Z)-3-(2-morpholin-4-ylethoxy)penta-2,4-dien-2-ol (PubChem CID 155441773) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2Z)-3-(2-morpholin-4-ylethoxy)penta-2,4-dien-2-ol.
| Compound Name | (2Z)-3-(2-morpholin-4-ylethoxy)penta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 155441773 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (2Z)-3-(2-morpholin-4-ylethoxy)penta-2,4-dien-2-ol |
| SMILES | C=C/C(OCCN1CCOCC1)=C(\C)O |
| InChI | InChI=1S/C11H19NO3/c1-3-11(10(2)13)15-9-6-12-4-7-14-8-5-12/h3,13H,1,4-9H2,2H3/b11-10- |
| InChIKey | OJVFGGBAIZRSCR-KHPPLWFESA-N |
| XLogP | 1.31 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|