C38H29N3 — CID 155443204
N'-[1-[4-[4-(3-cyanophenyl)naphthalen-1-yl]phenyl]-1-phenylethyl]benzenecarboximidamide (PubChem CID 155443204) has the molecular formula C38H29N3 and a molecular weight of 527.67 g/mol. Its IUPAC name is N'-[1-[4-[4-(3-cyanophenyl)naphthalen-1-yl]phenyl]-1-phenylethyl]benzenecarboximidamide.
| Compound Name | N'-[1-[4-[4-(3-cyanophenyl)naphthalen-1-yl]phenyl]-1-phenylethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 155443204 |
| Molecular Formula | C38H29N3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N'-[1-[4-[4-(3-cyanophenyl)naphthalen-1-yl]phenyl]-1-phenylethyl]benzenecarboximidamide |
| SMILES | CC(/N=C(\N)c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3cccc(C#N)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H29N3/c1-38(31-15-6-3-7-16-31,41-37(40)29-12-4-2-5-13-29)32-21-19-28(20-22-32)33-23-24-34(36-18-9-8-17-35(33)36)30-14-10-11-27(25-30)26-39/h2-25H,1H3,(H2,40,41) |
| InChIKey | UPQILURSMWKHHF-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|