C14H15N3O7 — CID 155444715
(2,5-dioxopyrrolidin-1-yl) 2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]acetate (PubChem CID 155444715) has the molecular formula C14H15N3O7 and a molecular weight of 337.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]acetate |
|---|---|
| PubChem CID | 155444715 |
| Molecular Formula | C14H15N3O7 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]acetate |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H15N3O7/c18-9(2-1-7-16-10(19)3-4-11(16)20)15-8-14(23)24-17-12(21)5-6-13(17)22/h3-4H,1-2,5-8H2,(H,15,18) |
| InChIKey | CTOWMXDQZGLCGF-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|