C26H50O3 — CID 155445154
3-methyldecan-2-yl [(Z)-2,4,7,9-tetramethyldec-5-en-2-yl] carbonate (PubChem CID 155445154) has the molecular formula C26H50O3 and a molecular weight of 410.68 g/mol. Its IUPAC name is 3-methyldecan-2-yl [(Z)-2,4,7,9-tetramethyldec-5-en-2-yl] carbonate.
| Compound Name | 3-methyldecan-2-yl [(Z)-2,4,7,9-tetramethyldec-5-en-2-yl] carbonate |
|---|---|
| PubChem CID | 155445154 |
| Molecular Formula | C26H50O3 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.38 |
| IUPAC Name | 3-methyldecan-2-yl [(Z)-2,4,7,9-tetramethyldec-5-en-2-yl] carbonate |
| SMILES | CCCCCCCC(C)C(C)OC(=O)OC(C)(C)CC(C)/C=C\C(C)CC(C)C |
| InChI | InChI=1S/C26H50O3/c1-10-11-12-13-14-15-23(6)24(7)28-25(27)29-26(8,9)19-22(5)17-16-21(4)18-20(2)3/h16-17,20-24H,10-15,18-19H2,1-9H3/b17-16- |
| InChIKey | JSGBRWZFVLIAPY-MSUUIHNZSA-N |
| XLogP | 8.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|