C34H58N2O2 — CID 155446165
(4aS,6aR,6aS,6bR,8aR,10S,12aR)-N-[2-(dimethylamino)ethyl]-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicene-4a-carboxamide (PubChem CID 155446165) has the molecular formula C34H58N2O2 and a molecular weight of 526.85 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,8aR,10S,12aR)-N-[2-(dimethylamino)ethyl]-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicene-4a-carboxamide.
| Compound Name | (4aS,6aR,6aS,6bR,8aR,10S,12aR)-N-[2-(dimethylamino)ethyl]-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicene-4a-carboxamide |
|---|---|
| PubChem CID | 155446165 |
| Molecular Formula | C34H58N2O2 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.45 |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aR,10S,12aR)-N-[2-(dimethylamino)ethyl]-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicene-4a-carboxamide |
| SMILES | CN(C)CCNC(=O)[C@]12CCC(C)(C)CC1=C1CC[C@@H]3[C@@]4(C)CC[C@H](O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H58N2O2/c1-29(2)16-18-34(28(38)35-20-21-36(8)9)19-17-32(6)23(24(34)22-29)10-11-26-31(5)14-13-27(37)30(3,4)25(31)12-15-33(26,32)7/h25-27,37H,10-22H2,1-9H3,(H,35,38)/t25-,26+,27-,31-,32+,33+,34-/m0/s1 |
| InChIKey | IAXFIUQLUGBSAO-MVZDXJNUSA-N |
| XLogP | 6.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|