C35H57NO2 — CID 155446660
[(4aS,6aR,6aS,6bR,8aS,10S,12aS)-2,2,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-4a-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 155446660) has the molecular formula C35H57NO2 and a molecular weight of 523.85 g/mol. Its IUPAC name is [(4aS,6aR,6aS,6bR,8aS,10S,12aS)-2,2,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-4a-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | [(4aS,6aR,6aS,6bR,8aS,10S,12aS)-2,2,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-4a-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 155446660 |
| Molecular Formula | C35H57NO2 |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.44 |
| IUPAC Name | [(4aS,6aR,6aS,6bR,8aS,10S,12aS)-2,2,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-4a-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | C[C@H]1CC[C@]2(C)[C@H]3CCC4=C5CC(C)(C)CC[C@]5(C(=O)N5CC[C@H](O)C5)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C35H57NO2/c1-23-11-14-32(6)27(31(23,4)5)12-15-34(8)28(32)10-9-25-26-21-30(2,3)16-18-35(26,19-17-33(25,34)7)29(38)36-20-13-24(37)22-36/h23-24,27-28,37H,9-22H2,1-8H3/t23-,24-,27-,28+,32-,33+,34+,35-/m0/s1 |
| InChIKey | VSMXWCOEXDEIGM-XLNAULIFSA-N |
| XLogP | 8.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|