C29H46O2 — CID 163007629
10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,4a,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-5-one (PubChem CID 163007629) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,4a,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-5-one.
| Compound Name | 10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,4a,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-5-one |
|---|---|
| PubChem CID | 163007629 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,4a,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicen-5-one |
| SMILES | CC1(C)CCC2C(=O)CC3(C)C(=C2C1)CCC1C2(C)CCC(O)C(C)(C)C2CCC13C |
| InChI | InChI=1S/C29H46O2/c1-25(2)13-10-18-19(16-25)20-8-9-23-27(5)14-12-24(31)26(3,4)22(27)11-15-28(23,6)29(20,7)17-21(18)30/h18,22-24,31H,8-17H2,1-7H3 |
| InChIKey | KEBNFNINPQTCOU-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|